|
CAS#: 140226-30-8 Product: (2R)-2-Acetamido-3-(3-Oxopropylsulfanyl)Propanoic Acid No suppilers available for the product. |
| Name | (2R)-2-Acetamido-3-(3-Oxopropylsulfanyl)Propanoic Acid |
|---|---|
| Synonyms | (2R)-2-Acetamido-3-(3-Oxopropylthio)Propanoic Acid; (2R)-2-Acetamido-3-(3-Ketopropylthio)Propionic Acid; S-(3-Oxopropyl)-N-Acetylcysteine |
| Molecular Structure | ![]() |
| Molecular Formula | C8H13NO4S |
| Molecular Weight | 219.26 |
| CAS Registry Number | 140226-30-8 |
| SMILES | [C@H](C(=O)O)(NC(=O)C)CSCCC=O |
| InChI | 1S/C8H13NO4S/c1-6(11)9-7(8(12)13)5-14-4-2-3-10/h3,7H,2,4-5H2,1H3,(H,9,11)(H,12,13)/t7-/m0/s1 |
| InChIKey | OOMVCGSUXLINOO-ZETCQYMHSA-N |
| Density | 1.269g/cm3 (Cal.) |
|---|---|
| Boiling point | 499.52°C at 760 mmHg (Cal.) |
| Flash point | 255.901°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2R)-2-Acetamido-3-(3-Oxopropylsulfanyl)Propanoic Acid |