|
CAS#: 14025-74-2 Product: 2-Cyano-2-Propanyl 2-Methyl-3-Phenylpropanoate No suppilers available for the product. |
| Name | 2-Cyano-2-Propanyl 2-Methyl-3-Phenylpropanoate |
|---|---|
| Synonyms | 1-Cyano-1-methylethyl 2-methyl-3-phenylpropanoate #; Hydrocinn |
| Molecular Structure | ![]() |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.29 |
| CAS Registry Number | 14025-74-2 |
| SMILES | N#CC(OC(=O)C(C)Cc1ccccc1)(C)C |
| InChI | 1S/C14H17NO2/c1-11(9-12-7-5-4-6-8-12)13(16)17-14(2,3)10-15/h4-8,11H,9H2,1-3H3 |
| InChIKey | XEDVWNPHTBYLAR-UHFFFAOYSA-N |
| Density | 1.058g/cm3 (Cal.) |
|---|---|
| Boiling point | 349.323°C at 760 mmHg (Cal.) |
| Flash point | 166.458°C (Cal.) |
| Refractive index | 1.509 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Cyano-2-Propanyl 2-Methyl-3-Phenylpropanoate |