Online Database of Chemicals from Around the World
|
CAS#: 14028-80-9 Product: 2-Allyl-4-[(1E)-5-(Dimethylamino)-1-Penten-1-Yl]-N,N-Dimethyl-3,5-Diphenylcyclohexanamine No suppilers available for the product. |
| Name | 2-Allyl-4-[(1E)-5-(Dimethylamino)-1-Penten-1-Yl]-N,N-Dimethyl-3,5-Diphenylcyclohexanamine |
|---|---|
| Synonyms | 2-Allyl-4 |
| Molecular Structure | ![CAS#: 14028-80-9, 2-Allyl-4-[(1E)-5-(Dimethylamino)-1-Penten-1-Yl]-N,N-Dimethyl-3,5-Diphenylcyclohexanamine](/moreStructures/14028-80-9.gif) |
| Molecular Formula | C30H42N2 |
| Molecular Weight | 430.67 |
| CAS Registry Number | 14028-80-9 |
| SMILES | N(C)(C)C3CC(c1ccccc1)C(/C=C/CCCN(C)C)C(c2ccccc2)C3C\C=C |
| InChI | 1S/C30H42N2/c1-6-16-27-29(32(4)5)23-28(24-17-10-7-11-18-24)26(21-14-9-15-22-31(2)3)30(27)25-19-12-8-13-20-25/h6-8,10-14,17-21,26-30H,1,9,15-16,22-23H2,2-5H3/b21-14+ |
| InChIKey | OSKINBOKJRREOW-KGENOOAVSA-N |
| Density | 1.005g/cm3 (Cal.) |
|---|---|
| Boiling point | 527.9°C at 760 mmHg (Cal.) |
| Flash point | 233.328°C (Cal.) |
| Refractive index | 1.568 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Allyl-4-[(1E)-5-(Dimethylamino)-1-Penten-1-Yl]-N,N-Dimethyl-3,5-Diphenylcyclohexanamine |