|
CAS#: 14031-86-8 Product: 2,4,4,6,6-Pentamethylhept-1-Ene No suppilers available for the product. |
| Name | 2,4,4,6,6-Pentamethylhept-1-Ene |
|---|---|
| Synonyms | 1-Heptene, 2,4,4,6,6-Pentamethyl-; 2,4,4,6,6-Pentamethylheptene-1 |
| Molecular Structure | ![]() |
| Molecular Formula | C12H24 |
| Molecular Weight | 168.32 |
| CAS Registry Number | 14031-86-8 |
| EINECS | 237-869-2 |
| SMILES | C(C(=C)C)C(C)(C)CC(C)(C)C |
| InChI | 1S/C12H24/c1-10(2)8-12(6,7)9-11(3,4)5/h1,8-9H2,2-7H3 |
| InChIKey | NSSBKMKRTGHAAN-UHFFFAOYSA-N |
| Density | 0.76g/cm3 (Cal.) |
|---|---|
| Boiling point | 190.857°C at 760 mmHg (Cal.) |
| Flash point | 56.714°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4,4,6,6-Pentamethylhept-1-Ene |