| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Classification | Biochemical >> Amino acids and their derivatives >> Lysine derivative |
|---|---|
| Name | N-Acetyl-L-Phenylalanyl-L-Lysine |
| Synonyms | (2S)-2-[[(2S)-2-Acetamido-3-Phenyl-Propanoyl]Amino]-6-Amino-Hexanoic Acid; (2S)-2-[[(2S)-2-Acetamido-1-Oxo-3-Phenylpropyl]Amino]-6-Aminohexanoic Acid; N-Acetylphenylalanyllysine |
| Molecular Structure | ![]() |
| Molecular Formula | C17H25N3O4 |
| Molecular Weight | 335.40 |
| CAS Registry Number | 14287-21-9 |
| SMILES | [C@H](C(=O)O)(NC([C@@H](NC(=O)C)CC1=CC=CC=C1)=O)CCCCN |
| InChI | 1S/C17H25N3O4/c1-12(21)19-15(11-13-7-3-2-4-8-13)16(22)20-14(17(23)24)9-5-6-10-18/h2-4,7-8,14-15H,5-6,9-11,18H2,1H3,(H,19,21)(H,20,22)(H,23,24)/t14-,15-/m0/s1 |
| InChIKey | AVXRNUMVGRLMBL-GJZGRUSLSA-N |
| Density | 1.19g/cm3 (Cal.) |
|---|---|
| Boiling point | 681.225°C at 760 mmHg (Cal.) |
| Flash point | 365.792°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Acetyl-L-Phenylalanyl-L-Lysine |