|
CAS#: 15486-23-4 Product: Euphococcinine No suppilers available for the product. |
| Name | Euphococcinine |
|---|---|
| Synonyms | 9-Azabicyclo(3.3.1)Nonan-3-One, 1-Methyl-, (1S)-; Euphococcinine |
| Molecular Structure | ![]() |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 |
| CAS Registry Number | 15486-23-4 |
| SMILES | [C@]12(N[C@@H](CC(=O)C1)CCC2)C |
| InChI | 1S/C9H15NO/c1-9-4-2-3-7(10-9)5-8(11)6-9/h7,10H,2-6H2,1H3/t7-,9+/m1/s1 |
| InChIKey | BWXDELRNNYLLKB-APPZFPTMSA-N |
| Density | 1.035g/cm3 (Cal.) |
|---|---|
| Boiling point | 238.934°C at 760 mmHg (Cal.) |
| Flash point | 99.521°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Euphococcinine |