| Alfa Aesar. | USA | |||
|---|---|---|---|---|
![]() |
+1 (978) 521-6300 | |||
![]() |
info@alfa.com | |||
| Chemical manufacturer | ||||
| Apollo Scientific Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (161) 406-0505 | |||
![]() |
sales@apolloscientific.co.uk | |||
| Chemical manufacturer | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Indofine Chemical Company, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (908) 359-6778 | |||
![]() |
fo@indofinechemical.com | |||
| Chemical manufacturer since 1996 | ||||
| P and M Invest Ltd. | Russian Federation | |||
|---|---|---|---|---|
![]() |
+7 (495) 135-6494 | |||
![]() |
sales@fluorine.ru | |||
| Chemical manufacturer | ||||
| Zylexa Pharma Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | 2,2,3,3,4,4,4-Heptafluoro-Butanoic Acid Butyl Ester |
|---|---|
| Synonyms | 2,2,3,3,4,4,4-Heptafluorobutanoic Acid Butyl Ester; 2,2,3,3,4,4,4-Heptafluorobutyric Acid Butyl Ester; Butyric Acid, Heptafluoro-, Butyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C8H9F7O2 |
| Molecular Weight | 270.15 |
| CAS Registry Number | 1559-07-5 |
| SMILES | C(CCC)OC(C(C(C(F)(F)F)(F)F)(F)F)=O |
| InChI | 1S/C8H9F7O2/c1-2-3-4-17-5(16)6(9,10)7(11,12)8(13,14)15/h2-4H2,1H3 |
| InChIKey | YDXXJZKOOOJVEE-UHFFFAOYSA-N |
| Density | 1.296 (Expl.) |
|---|---|
| 1.3±0.1g/cm3 (Cal.) | |
| Boiling point | 132°C (Expl.) |
| 146.1±35.0°C at 760 mmHg (Cal.) | |
| Flash point | 41.7±20.8°C (Cal.) |
| Refractive index | 1.327 (Expl.) |
| Safety Code | S26;S37 Details |
|---|---|
| Risk Code | R36/37/38 Details |
| Hazard Symbol | X Details |
| Safety Description | CAUTION: May irritate eyes, skin, and respiratory tract |
| WARNING: Irritates lungs, eyes, skin | |
| SDS | Available |
| Market Analysis Reports |