| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 13417589054//+86 13424336463 | |||
![]() |
info@atomaxchem.com,atomax.chemicals@gmail.com, | |||
![]() |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | N-Cyclopropyl-N-Methylbenzamide |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 |
| CAS Registry Number | 155940-92-4 |
| SMILES | CN(C1CC1)C(=O)C2=CC=CC=C2 |
| InChI | 1S/C11H13NO/c1-12(10-7-8-10)11(13)9-5-3-2-4-6-9/h2-6,10H,7-8H2,1H3 |
| InChIKey | YJGOXHXGSNBHRI-UHFFFAOYSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 303.2±11.0°C at 760 mmHg (Cal.) |
| Flash point | 137.6±10.5°C (Cal.) |
| Refractive index | 1.571 (Cal.) |
| (1) | Luis Constantino and Jim Iley. Oxidation of tertiary benzamides by 5,10,15,20-tetraphenylporphyrinatoiron chloride–tert-butylhydroperoxide, Org. Biomol. Chem., 2004, 2, 1894. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for N-Cyclopropyl-N-Methylbenzamide |