|
CAS#: 158091-62-4 Product: 6-Fluoropregn-4-Ene-3,20-Dione No suppilers available for the product. |
| Name | 6-Fluoropregn-4-Ene-3,20-Dione |
|---|---|
| Synonyms | 6-fluoroprogesterone |
| Molecular Structure | ![]() |
| Molecular Formula | C21H29FO2 |
| Molecular Weight | 332.45 |
| CAS Registry Number | 158091-62-4 |
| SMILES | CC(=O)[C@H]2CC[C@H]3[C@@H]4CC(F)\C1=C\C(=O)CC[C@]1(C)[C@H]4CC[C@]23C |
| InChI | 1S/C21H29FO2/c1-12(23)15-4-5-16-14-11-19(22)18-10-13(24)6-8-21(18,3)17(14)7-9-20(15,16)2/h10,14-17,19H,4-9,11H2,1-3H3/t14-,15+,16-,17-,19?,20+,21+/m0/s1 |
| InChIKey | UZROOFLUFHWOJQ-UHPWKVKZSA-N |
| Density | 1.129g/cm3 (Cal.) |
|---|---|
| Boiling point | 449.284°C at 760 mmHg (Cal.) |
| Flash point | 169.672°C (Cal.) |
| Refractive index | 1.53 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Fluoropregn-4-Ene-3,20-Dione |