|
CAS#: 15968-00-0 Product: Dilithium Phthalate No suppilers available for the product. |
| Name | Dilithium Phthalate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C8H4Li2O4 |
| Molecular Weight | 178.00 |
| CAS Registry Number | 15968-00-0 |
| EINECS | 240-105-0 |
| SMILES | C1=CC=CC(=C1C([O-])=O)C([O-])=O.[Li+].[Li+] |
| InChI | 1S/C8H6O4.2Li/c9-7(10)5-3-1-2-4-6(5)8(11)12;;/h1-4H,(H,9,10)(H,11,12);;/q;2*+1/p-2 |
| InChIKey | VNSVQJIXVXZDJF-UHFFFAOYSA-L |
| Boiling point | 378.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 196.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dilithium Phthalate |