Online Database of Chemicals from Around the World
|
CAS#: 16714-57-1 Product: 2-Amino-1,7-Dihydro-1-Methyl-6H-Purine-6-Thione No suppilers available for the product. |
| Name | 2-Amino-1,7-Dihydro-1-Methyl-6H-Purine-6-Thione |
|---|---|
| Synonyms | Guanine, Methylthio-; 1-Methylthioguanine; 6H-Purine-6-Thione, 2-Amino-1,7-Dihydro-1-Methyl- |
| Molecular Structure |  |
| Molecular Formula | C6H7N5S |
| Molecular Weight | 181.21 |
| CAS Registry Number | 16714-57-1 |
| SMILES | C1=NC2=C([NH]1)C(N(C(=N2)N)C)=S |
| InChI | 1S/C6H7N5S/c1-11-5(12)3-4(9-2-8-3)10-6(11)7/h2H,1H3,(H2,7,10)(H,8,9) |
| InChIKey | FBUTXZSKZCQABC-UHFFFAOYSA-N |
| Density | 1.784g/cm3 (Cal.) |
|---|---|
| Boiling point | 507.937°C at 760 mmHg (Cal.) |
| Flash point | 260.991°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Amino-1,7-Dihydro-1-Methyl-6H-Purine-6-Thione |