Online Database of Chemicals from Around the World
| Santa Cruz Biotechnology, Inc. | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (831) 457-3800 | |||
 |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Sigma-Aldrich, Inc. | USA | Inquire | ||
|---|---|---|---|---|
|
+86 (21) 6141-5566 / 800-819-3336 | |||
|
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Name | 2,3-Dihydro-6H-[1,4]Dioxino[2,3-c]Pyrrole-5,7-Dicarboxylic Acid |
|---|---|
| Synonyms | 3,4-Ethylenedioxypyrrole-2,5-dicarboxylic acid; 6H-1,4-DI |
| Molecular Structure | ![CAS#: 169616-13-1, 2,3-Dihydro-6H-[1,4]Dioxino[2,3-c]Pyrrole-5,7-Dicarboxylic Acid](/moreStructures/169616-13-1.gif) |
| Molecular Formula | C8H7NO6 |
| Molecular Weight | 213.14 |
| CAS Registry Number | 169616-13-1 |
| SMILES | O=C(O)c1nc(c2OCCOc12)C(=O)O |
| InChI | 1S/C8H7NO6/c10-7(11)3-5-6(15-2-1-14-5)4(9-3)8(12)13/h9H,1-2H2,(H,10,11)(H,12,13) |
| InChIKey | MUKLTUYFKHGLDJ-UHFFFAOYSA-N |
| Density | 1.75g/cm3 (Cal.) |
|---|---|
| Boiling point | 545.5°C at 760 mmHg (Cal.) |
| Flash point | 283.7°C (Cal.) |
| Refractive index | 1.667 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3-Dihydro-6H-[1,4]Dioxino[2,3-c]Pyrrole-5,7-Dicarboxylic Acid |