|
CAS#: 1705-16-4 Product: 1-Phenyl-3-(Trifluoromethyl)-3-Buten-1-Ol No suppilers available for the product. |
| Name | 1-Phenyl-3-(Trifluoromethyl)-3-Buten-1-Ol |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C11H11F3O |
| Molecular Weight | 216.20 |
| CAS Registry Number | 1705-16-4 |
| SMILES | OC(CC(=C)C(F)(F)F)c1ccccc1 |
| InChI | 1S/C11H11F3O/c1-8(11(12,13)14)7-10(15)9-5-3-2-4-6-9/h2-6,10,15H,1,7H2 |
| InChIKey | WZSLIAQQTMWRGZ-UHFFFAOYSA-N |
| Density | 1.192g/cm3 (Cal.) |
|---|---|
| Boiling point | 265.574°C at 760 mmHg (Cal.) |
| Flash point | 114.625°C (Cal.) |
| Refractive index | 1.477 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1-Phenyl-3-(Trifluoromethyl)-3-Buten-1-Ol |