| Name | 4-((2-Methylphenyl)amino)-4-oxobutanoic acid compd. with 4,5-dihydro-2-thiazolamine (1:1) |
|---|---|
| Synonyms | 4,5-Dihydrothiazol-2-Amine; 4-(O-Tolylamino)-4-Oxo-Butanoic Acid; 4,5-Dihydrothiazol-2-Amine; 4-(O-Tolylamino)-4-Oxobutanoic Acid; 4,5-Dihydrothiazol-2-Ylamine; 4-Keto-4-(O-Toluidino)Butyric Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C14H19N3O3S |
| Molecular Weight | 309.38 |
| CAS Registry Number | 171088-71-4 |
| SMILES | C1SC(=NC1)N.C2=C(C(=CC=C2)NC(=O)CCC(=O)O)C |
| InChI | 1S/C11H13NO3.C3H6N2S/c1-8-4-2-3-5-9(8)12-10(13)6-7-11(14)15;4-3-5-1-2-6-3/h2-5H,6-7H2,1H3,(H,12,13)(H,14,15);1-2H2,(H2,4,5) |
| InChIKey | BOBZJEDZBZZMOC-UHFFFAOYSA-N |
| Boiling point | 440.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 220.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-((2-Methylphenyl)amino)-4-oxobutanoic acid compd. with 4,5-dihydro-2-thiazolamine (1:1) |