|
CAS#: 1860-21-5 Product: 2-Methyl-2-Propanyl Trichloroacetate No suppilers available for the product. |
| Name | 2-Methyl-2-Propanyl Trichloroacetate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C6H9Cl3O2 |
| Molecular Weight | 219.49 |
| CAS Registry Number | 1860-21-5 |
| SMILES | ClC(Cl)(Cl)C(=O)OC(C)(C)C |
| InChI | 1S/C6H9Cl3O2/c1-5(2,3)11-4(10)6(7,8)9/h1-3H3 |
| InChIKey | YROVKSCEXQTHTJ-UHFFFAOYSA-N |
| Density | 1.328g/cm3 (Cal.) |
|---|---|
| Boiling point | 195.062°C at 760 mmHg (Cal.) |
| Flash point | 67.165°C (Cal.) |
| Refractive index | 1.47 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-2-Propanyl Trichloroacetate |