|
CAS#: 189-96-8 Product: Benzo(pqr)Picene No suppilers available for the product. |
| Name | Benzo(pqr)Picene |
|---|---|
| Synonyms | Naphtho(2,1-A)Pyrene; Naphtho(3',4':3,4)Pyrene |
| Molecular Structure | ![]() |
| Molecular Formula | C24H14 |
| Molecular Weight | 302.37 |
| CAS Registry Number | 189-96-8 |
| EINECS | 205-879-6 |
| SMILES | C2=C4C1=C3C(=CC=C1C=C2)C=C5C(=C3C=C4)C=CC6=CC=CC=C56 |
| InChI | 1S/C24H14/c1-2-7-19-15(4-1)10-12-20-21-13-11-17-6-3-5-16-8-9-18(14-22(19)20)24(21)23(16)17/h1-14H |
| InChIKey | VOIIGLOUBINLKK-UHFFFAOYSA-N |
| Density | 1.313g/cm3 (Cal.) |
|---|---|
| Boiling point | 552.265°C at 760 mmHg (Cal.) |
| Flash point | 281.957°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Benzo(pqr)Picene |