|
CAS#: 19164-54-6 Product: 2-(2,3-Diphenyl-2-Cyclopropen-1-Ylidene)-1H-Indene-1,3(2H)-Dione No suppilers available for the product. |
| Name | 2-(2,3-Diphenyl-2-Cyclopropen-1-Ylidene)-1H-Indene-1,3(2H)-Dione |
|---|---|
| Synonyms | 2-(2,3-Di |
| Molecular Structure | ![]() |
| Molecular Formula | C24H14O2 |
| Molecular Weight | 334.37 |
| CAS Registry Number | 19164-54-6 |
| SMILES | O=C/2c1ccccc1C(=O)C\2=C\5/C(/c3ccccc3)=C/5/c4ccccc4 |
| InChI | 1S/C24H14O2/c25-23-17-13-7-8-14-18(17)24(26)22(23)21-19(15-9-3-1-4-10-15)20(21)16-11-5-2-6-12-16/h1-14H |
| InChIKey | MQUKJLWFTUGGNU-UHFFFAOYSA-N |
| Density | 1.363g/cm3 (Cal.) |
|---|---|
| Boiling point | 550.646°C at 760 mmHg (Cal.) |
| Flash point | 201.824°C (Cal.) |
| Refractive index | 1.737 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(2,3-Diphenyl-2-Cyclopropen-1-Ylidene)-1H-Indene-1,3(2H)-Dione |