|
CAS#: 19888-33-6 Product: (1R,4E,7E,11R)-1,5,9,9-Tetramethyl-12-Oxabicyclo[9.1.0]Dodeca-4,7-Diene No suppilers available for the product. |
| Name | (1R,4E,7E,11R)-1,5,9,9-Tetramethyl-12-Oxabicyclo[9.1.0]Dodeca-4,7-Diene |
|---|---|
| Synonyms | humulene epoxide I; Humulene oxide I |
| Molecular Structure | ![]() |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.35 |
| CAS Registry Number | 19888-33-6 |
| SMILES | C/C/1=C\CC[C@@]2([C@H](O2)CC(/C=C/C1)(C)C)C |
| InChI | 1S/C15H24O/c1-12-7-5-9-14(2,3)11-13-15(4,16-13)10-6-8-12/h5,8-9,13H,6-7,10-11H2,1-4H3/b9-5+,12-8+/t13-,15-/m1/s1 |
| InChIKey | RKQDKXOBRXTSFS-UOAUIWSESA-N |
| Density | 0.9±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 283.1±29.0°C at 760 mmHg (Cal.) |
| Flash point | 121.7±22.3°C (Cal.) |
| Refractive index | 1.474 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1R,4E,7E,11R)-1,5,9,9-Tetramethyl-12-Oxabicyclo[9.1.0]Dodeca-4,7-Diene |