|
CAS#: 19912-83-5 Product: alpha-Chamigrene No suppilers available for the product. |
| Name | alpha-Chamigrene |
|---|---|
| Synonyms | C09635; Alpha-Chamigrene |
| Molecular Structure | ![]() |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.35 |
| CAS Registry Number | 19912-83-5 |
| SMILES | [C@]12(C(CCC=C1C)(C)C)CCC(=CC2)C |
| InChI | 1S/C15H24/c1-12-7-10-15(11-8-12)13(2)6-5-9-14(15,3)4/h6-7H,5,8-11H2,1-4H3/t15-/m1/s1 |
| InChIKey | SIBCECUUMHIAAM-OAHLLOKOSA-N |
| Density | 0.905g/cm3 (Cal.) |
|---|---|
| Boiling point | 272.667°C at 760 mmHg (Cal.) |
| Flash point | 107.034°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for alpha-Chamigrene |