|
CAS#: 20584-81-0 Product: N-delta-Chloroacetyl-L-Ornithine No suppilers available for the product. |
| Name | N-delta-Chloroacetyl-L-Ornithine |
|---|---|
| Synonyms | (2S)-2-Amino-5-[(2-Chloro-1-Oxoethyl)Amino]Pentanoic Acid; (2S)-2-Amino-5-[(2-Chloroacetyl)Amino]Valeric Acid; (2S)-2-Amino-5-(2-Chloroethanoylamino)Pentanoic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C7H13ClN2O3 |
| Molecular Weight | 208.64 |
| CAS Registry Number | 20584-81-0 |
| SMILES | [C@H](C(=O)O)(N)CCCNC(=O)CCl |
| InChI | 1S/C7H13ClN2O3/c8-4-6(11)10-3-1-2-5(9)7(12)13/h5H,1-4,9H2,(H,10,11)(H,12,13)/t5-/m0/s1 |
| InChIKey | YOHUBSGWLQBGKD-YFKPBYRVSA-N |
| Density | 1.303g/cm3 (Cal.) |
|---|---|
| Boiling point | 469.011°C at 760 mmHg (Cal.) |
| Flash point | 237.45°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-delta-Chloroacetyl-L-Ornithine |