|
CAS#: 21898-45-3 Product: Ethyl 1-Methyl-alpha-Oxo-1H-Pyrrole-2-Acetate No suppilers available for the product. |
| Name | Ethyl 1-Methyl-alpha-Oxo-1H-Pyrrole-2-Acetate |
|---|---|
| Synonyms | Ethyl 2-(1-Methylpyrrol-2-Yl)-2-Oxo-Acetate; 2-(1-Methyl-2-Pyrrolyl)-2-Oxoacetic Acid Ethyl Ester; 2-Keto-2-(1-Methylpyrrol-2-Yl)Acetic Acid Ethyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C9H11NO3 |
| Molecular Weight | 181.19 |
| CAS Registry Number | 21898-45-3 |
| EINECS | 244-644-2 |
| SMILES | C1=C(C(C(=O)OCC)=O)[N](C=C1)C |
| InChI | 1S/C9H11NO3/c1-3-13-9(12)8(11)7-5-4-6-10(7)2/h4-6H,3H2,1-2H3 |
| InChIKey | HZSVMMXNUWDJPP-UHFFFAOYSA-N |
| Density | 1.139g/cm3 (Cal.) |
|---|---|
| Boiling point | 278.311°C at 760 mmHg (Cal.) |
| Flash point | 122.118°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 1-Methyl-alpha-Oxo-1H-Pyrrole-2-Acetate |