|
CAS#: 22167-99-3 Product: 5-Chloro-2,4-Thiophenedi(Sulfonamide) No suppilers available for the product. |
| Name | 5-Chloro-2,4-Thiophenedi(Sulfonamide) |
|---|---|
| Synonyms | 2,4-Thiophenedisulfonamide, 5-Chloro-; 5-Chloro-2,4-Thiophenedisulfonamide; Brn 0248113 |
| Molecular Structure | ![]() |
| Molecular Formula | C4H5ClN2O4S3 |
| Molecular Weight | 276.73 |
| CAS Registry Number | 22167-99-3 |
| SMILES | C1=C([S](N)(=O)=O)SC(=C1[S](N)(=O)=O)Cl |
| InChI | 1S/C4H5ClN2O4S3/c5-4-2(13(6,8)9)1-3(12-4)14(7,10)11/h1H,(H2,6,8,9)(H2,7,10,11) |
| InChIKey | MYGOAWSTBUIRKA-UHFFFAOYSA-N |
| Density | 1.86g/cm3 (Cal.) |
|---|---|
| Boiling point | 584.307°C at 760 mmHg (Cal.) |
| Flash point | 307.178°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Chloro-2,4-Thiophenedi(Sulfonamide) |