|
CAS#: 239-12-3 Product: Thiochromeno[4,3-b]Indole No suppilers available for the product. |
| Name | Thiochromeno[4,3-b]Indole |
|---|---|
| Synonyms | Brn 1075508; Benz(B)Indolo(2,3-D)Thiopyran; (1)Benzothiopyrano(4,3-B)Indole |
| Molecular Structure | ![]() |
| Molecular Formula | C15H9NS |
| Molecular Weight | 235.30 |
| CAS Registry Number | 239-12-3 |
| SMILES | C1=CC=CC3=C1C2=CSC4=C(C2=N3)C=CC=C4 |
| InChI | 1S/C15H9NS/c1-3-7-13-10(5-1)12-9-17-14-8-4-2-6-11(14)15(12)16-13/h1-9H |
| InChIKey | LVRMUSVWQJOVKM-UHFFFAOYSA-N |
| Density | 1.313g/cm3 (Cal.) |
|---|---|
| Boiling point | 379.406°C at 760 mmHg (Cal.) |
| Flash point | 183.259°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Thiochromeno[4,3-b]Indole |