|
CAS#: 23915-26-6 Product: 5-(3,4-Dichlorophenyl)-2,5-Dihydro-3H-Imidazo[2,1-a]Isoindol-5-Ol No suppilers available for the product. |
| Name | 5-(3,4-Dichlorophenyl)-2,5-Dihydro-3H-Imidazo[2,1-a]Isoindol-5-Ol |
|---|---|
| Synonyms | 5-24-04-00403 (Beilstein Handbook Reference); 5-M,P-Dichlorophenyl-2,3-Dihydro-5H-Imidazo(2,1-A)Isoindol-5-Ol; 5H-Imidazo(2,1-A)Isoindol-5-Ol, 2,3-Dihydro-5-(3,4-Dichlorophenyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C16H12Cl2N2O |
| Molecular Weight | 319.19 |
| CAS Registry Number | 23915-26-6 |
| SMILES | C1=CC=CC3=C1C2=NCCN2C3(O)C4=CC(=C(C=C4)Cl)Cl |
| InChI | 1S/C16H12Cl2N2O/c17-13-6-5-10(9-14(13)18)16(21)12-4-2-1-3-11(12)15-19-7-8-20(15)16/h1-6,9,21H,7-8H2 |
| InChIKey | HIXQQSRYYLKPER-UHFFFAOYSA-N |
| Density | 1.499g/cm3 (Cal.) |
|---|---|
| Boiling point | 487.774°C at 760 mmHg (Cal.) |
| Flash point | 248.797°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-(3,4-Dichlorophenyl)-2,5-Dihydro-3H-Imidazo[2,1-a]Isoindol-5-Ol |