|
CAS#: 24910-69-8 Product: 1,4-Dichloro-2-Phenoxy-Benzene No suppilers available for the product. |
| Name | 1,4-Dichloro-2-Phenoxy-Benzene |
|---|---|
| Synonyms | 1,4-Dichloro-2-Phenoxybenzene; Benzene, 1,4-Dichloro-2-Phenoxy- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H8Cl2O |
| Molecular Weight | 239.10 |
| CAS Registry Number | 24910-69-8 |
| SMILES | C1=CC(=C(C=C1Cl)OC2=CC=CC=C2)Cl |
| InChI | 1S/C12H8Cl2O/c13-9-6-7-11(14)12(8-9)15-10-4-2-1-3-5-10/h1-8H |
| InChIKey | VITXVDNQHXYQSK-UHFFFAOYSA-N |
| Density | 1.3g/cm3 (Cal.) |
|---|---|
| Boiling point | 295.612°C at 760 mmHg (Cal.) |
| Flash point | 83.123°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,4-Dichloro-2-Phenoxy-Benzene |