|
CAS#: 2765-41-5 Product: 2,2'-Sulfanediylbis(1-Phenylethanol) No suppilers available for the product. |
| Name | 2,2'-Sulfanediylbis(1-Phenylethanol) |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C16H18O2S |
| Molecular Weight | 274.38 |
| CAS Registry Number | 2765-41-5 |
| SMILES | OC(c1ccccc1)CSCC(O)c2ccccc2 |
| InChI | 1S/C16H18O2S/c17-15(13-7-3-1-4-8-13)11-19-12-16(18)14-9-5-2-6-10-14/h1-10,15-18H,11-12H2 |
| InChIKey | UXXFFFKLKFFDHH-UHFFFAOYSA-N |
| Density | 1.212g/cm3 (Cal.) |
|---|---|
| Boiling point | 471.01°C at 760 mmHg (Cal.) |
| Flash point | 228.463°C (Cal.) |
| Refractive index | 1.631 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2'-Sulfanediylbis(1-Phenylethanol) |