|
CAS#: 27736-80-7 Product: Fenaftic acid No suppilers available for the product. |
| Name | Fenaftic acid |
|---|---|
| Synonyms | 1-(Diethylamino-Oxomethyl)-6,6-Dimethyl-8-Oxo-3-Phenyl-1,2,3,4,5,7-Hexahydronaphthalene-2-Carboxylic Acid; 1-(Diethylcarbamoyl)-8-Keto-6,6-Dimethyl-3-Phenyl-1,2,3,4,5,7-Hexahydronaphthalene-2-Carboxylic Acid; 1-(Diethylcarbamoyl)-1,2,3,4,5,6,7,8-Octahydro-6,6-Dimethyl-8-Oxo-3-Phenyl-2-Naphthoic Acid. |
| Molecular Structure | ![]() |
| Molecular Formula | C24H31NO4 |
| Molecular Weight | 397.51 |
| CAS Registry Number | 27736-80-7 |
| SMILES | C3=C(C1C(C(C2=C(C1)CC(C)(C)CC2=O)C(N(CC)CC)=O)C(O)=O)C=CC=C3 |
| InChI | 1S/C24H31NO4/c1-5-25(6-2)22(27)21-19-16(13-24(3,4)14-18(19)26)12-17(20(21)23(28)29)15-10-8-7-9-11-15/h7-11,17,20-21H,5-6,12-14H2,1-4H3,(H,28,29) |
| InChIKey | FUXLDXFRSJXUQG-UHFFFAOYSA-N |
| Density | 1.182g/cm3 (Cal.) |
|---|---|
| Boiling point | 593.286°C at 760 mmHg (Cal.) |
| Flash point | 312.609°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Fenaftic acid |