|
CAS#: 29962-83-2 Product: Di-tert-tetradecyl Disulfide No suppilers available for the product. |
| Name | Di-tert-tetradecyl Disulfide |
|---|---|
| Synonyms | 2,2,3,4,4,5,6-Heptamethyl-6-(1,1,2,3,3,4,5,5-Octamethylhexyldisulfanyl)Heptane; 2-(2,3,4,4,5,6,6-Heptamethylheptan-2-Yldisulfanyl)-2,3,4,4,5,6,6-Heptamethyl-Heptane |
| Molecular Structure | ![]() |
| Molecular Formula | C28H58S2 |
| Molecular Weight | 458.89 |
| CAS Registry Number | 29962-83-2 |
| EINECS | 249-977-7 |
| SMILES | CC(C(C(C(C(SSC(C(C(C(C(C)(C)C)C)(C)C)C)(C)C)(C)C)C)(C)C)C)(C)C |
| InChI | 1S/C28H58S2/c1-19(23(5,6)7)25(11,12)21(3)27(15,16)29-30-28(17,18)22(4)26(13,14)20(2)24(8,9)10/h19-22H,1-18H3 |
| InChIKey | PUZFDZFKIPUGSO-UHFFFAOYSA-N |
| Density | 0.882g/cm3 (Cal.) |
|---|---|
| Boiling point | 480.427°C at 760 mmHg (Cal.) |
| Flash point | 29.78°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Di-tert-tetradecyl Disulfide |