|
CAS#: 32150-68-8 Product: 1-(4-Chlorophenyl)-5-Dimethylamino-3,6-Dimethylpyrimidine-2,4-Dione No suppilers available for the product. |
| Name | 1-(4-Chlorophenyl)-5-Dimethylamino-3,6-Dimethylpyrimidine-2,4-Dione |
|---|---|
| Synonyms | 1-(4-Chlorophenyl)-5-Dimethylamino-3,6-Dimethyl-Pyrimidine-2,4-Dione; 1-(4-Chlorophenyl)-5-Dimethylamino-3,6-Dimethyl-Pyrimidine-2,4-Quinone; Uracil, 1-(P-Chlorophenyl)-5-(Dimethylamino)-3,6-Dimethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C14H16ClN3O2 |
| Molecular Weight | 293.75 |
| CAS Registry Number | 32150-68-8 |
| SMILES | C1=CC(=CC=C1N2C(=C(N(C)C)C(N(C2=O)C)=O)C)Cl |
| InChI | 1S/C14H16ClN3O2/c1-9-12(16(2)3)13(19)17(4)14(20)18(9)11-7-5-10(15)6-8-11/h5-8H,1-4H3 |
| InChIKey | YPGSWQHGZLTTGJ-UHFFFAOYSA-N |
| Density | 1.334g/cm3 (Cal.) |
|---|---|
| Boiling point | 401.697°C at 760 mmHg (Cal.) |
| Flash point | 196.739°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(4-Chlorophenyl)-5-Dimethylamino-3,6-Dimethylpyrimidine-2,4-Dione |