|
CAS#: 330-00-7 Product: Fluorosulfonyloxybenzene No suppilers available for the product. |
| Name | Fluorosulfonyloxybenzene |
|---|---|
| Synonyms | 3-06-00-00654 (Beilstein Handbook Reference); Brn 1948091; Fluorosulfuric Acid, Phenyl Ester (8Ci,9Ci) |
| Molecular Structure | ![]() |
| Molecular Formula | C6H5FO3S |
| Molecular Weight | 176.16 |
| CAS Registry Number | 330-00-7 |
| SMILES | C1=C(O[S](=O)(=O)F)C=CC=C1 |
| InChI | 1S/C6H5FO3S/c7-11(8,9)10-6-4-2-1-3-5-6/h1-5H |
| InChIKey | BDIBYQORZHGDIR-UHFFFAOYSA-N |
| Density | 1.428g/cm3 (Cal.) |
|---|---|
| Boiling point | 221.64°C at 760 mmHg (Cal.) |
| Flash point | 87.845°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Fluorosulfonyloxybenzene |