|
CAS#: 384-66-7 Product: 2,2-Dichloro-2-Fluoro-1-Phenylethanone No suppilers available for the product. |
| Name | 2,2-Dichloro-2-Fluoro-1-Phenylethanone |
|---|---|
| Synonyms | 2,2-Dichloro-2-Fluoro-1-Phenyl-Ethanone; Nsc42751 |
| Molecular Structure | ![]() |
| Molecular Formula | C8H5Cl2FO |
| Molecular Weight | 207.03 |
| CAS Registry Number | 384-66-7 |
| SMILES | C1=CC=CC=C1C(C(Cl)(Cl)F)=O |
| InChI | 1S/C8H5Cl2FO/c9-8(10,11)7(12)6-4-2-1-3-5-6/h1-5H |
| InChIKey | BUFWRQDRYOXTTP-UHFFFAOYSA-N |
| Density | 1.387g/cm3 (Cal.) |
|---|---|
| Boiling point | 229.057°C at 760 mmHg (Cal.) |
| Flash point | 92.331°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2-Dichloro-2-Fluoro-1-Phenylethanone |