Online Database of Chemicals from Around the World
|
CAS#: 41362-84-9 Product: N-(3,4-Dichlorophenyl)-2,3-Dihydroxy-2-Methylpropanamide No suppilers available for the product. |
| Name | N-(3,4-Dichlorophenyl)-2,3-Dihydroxy-2-Methylpropanamide |
|---|---|
| Synonyms | N-(3,4-Dichlorophenyl)-2,3-dihydroxy-2-methylpropanamide; N-(3,4-Dichlorophenyl)-2,3-dihydroxy-2-methylpropanamide # |
| Molecular Structure |  |
| Molecular Formula | C10H11Cl2NO3 |
| Molecular Weight | 264.11 |
| CAS Registry Number | 41362-84-9 |
| SMILES | Clc1ccc(NC(=O)C(O)(C)CO)cc1Cl |
| InChI | 1S/C10H11Cl2NO3/c1-10(16,5-14)9(15)13-6-2-3-7(11)8(12)4-6/h2-4,14,16H,5H2,1H3,(H,13,15) |
| InChIKey | FUXKZAWOTMUTLO-UHFFFAOYSA-N |
| Density | 1.514g/cm3 (Cal.) |
|---|---|
| Boiling point | 503.08°C at 760 mmHg (Cal.) |
| Flash point | 258.054°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(3,4-Dichlorophenyl)-2,3-Dihydroxy-2-Methylpropanamide |