Online Database of Chemicals from Around the World
|
CAS#: 4269-77-6 Product: 4,5-Dihydrotestolactone No suppilers available for the product. |
| Name | 4,5-Dihydrotestolactone |
|---|---|
| Synonyms | (4As,4Br,6Ar,10Ar,10Bs,12As)-10A,12A-Dimethyl-4,4A,4B,5,6,6A,7,10B,11,12-Decahydro-3H-Naphtho[6,5-F]Chromene-2,8-Quinone; 4,5-Dihydrotestolactone; D-Homo-17A-Oxaandrost-1-Ene-3,17-Dione, (5Beta)- |
| Molecular Structure |  |
| Molecular Formula | C19H26O3 |
| Molecular Weight | 302.41 |
| CAS Registry Number | 4269-77-6 |
| SMILES | [C@@]12(C=CC(C[C@H]1CC[C@@H]3[C@@H]2CC[C@]4([C@H]3CCC(O4)=O)C)=O)C |
| InChI | 1S/C19H26O3/c1-18-9-7-13(20)11-12(18)3-4-14-15(18)8-10-19(2)16(14)5-6-17(21)22-19/h7,9,12,14-16H,3-6,8,10-11H2,1-2H3/t12-,14-,15+,16+,18+,19+/m1/s1 |
| InChIKey | CVGNVLKFFBPCIQ-UTQPNVHDSA-N |
| Density | 1.123g/cm3 (Cal.) |
|---|---|
| Boiling point | 464.933°C at 760 mmHg (Cal.) |
| Flash point | 205.003°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,5-Dihydrotestolactone |