|
CAS#: 427-39-4 Product: 4-Fluoro-alpha,alpha-DiphenylBenzenemethanol No suppilers available for the product. |
| Name | 4-Fluoro-alpha,alpha-DiphenylBenzenemethanol |
|---|---|
| Synonyms | Methanol,Diphenyl,4-Fluorophenyl; Benzenemethanol, 4-Fluoro-Alpha,Alpha-Diphenyl-; Inchi=1/C19h15fo/C20-18-13-11-17(12-14-18)19(21,15-7-3-1-4-8-15)16-9-5-2-6-10-16/H1-14,21 |
| Molecular Structure | ![]() |
| Molecular Formula | C19H15FO |
| Molecular Weight | 278.33 |
| CAS Registry Number | 427-39-4 |
| SMILES | C3=C(C(O)(C1=CC=CC=C1)C2=CC=CC=C2)C=CC(=C3)F |
| InChI | 1S/C19H15FO/c20-18-13-11-17(12-14-18)19(21,15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-14,21H |
| InChIKey | QMXYSLLUMFAPGO-UHFFFAOYSA-N |
| Density | 1.187g/cm3 (Cal.) |
|---|---|
| Boiling point | 412.558°C at 760 mmHg (Cal.) |
| Flash point | 243.984°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Fluoro-alpha,alpha-DiphenylBenzenemethanol |