| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Name | 3-Iodoadamantane-1-Carboxylic Acid |
|---|---|
| Synonyms | 3-Iodo-1-Adamantanecarboxylic Acid; 1-Iodo-3-Adamantanecarboxylic Acid; 3-Adamantanecarboxylic Acid, 1-Iodo- |
| Molecular Structure | ![]() |
| Molecular Formula | C11H15IO2 |
| Molecular Weight | 306.14 |
| CAS Registry Number | 42711-77-3 |
| SMILES | O=C(O)C23CC1CC(CC(I)(C1)C2)C3 |
| InChI | 1S/C11H15IO2/c12-11-4-7-1-8(5-11)3-10(2-7,6-11)9(13)14/h7-8H,1-6H2,(H,13,14) |
| InChIKey | VMCNPOBDWYHJAP-UHFFFAOYSA-N |
| Density | 1.792g/cm3 (Cal.) |
|---|---|
| Boiling point | 376.96°C at 760 mmHg (Cal.) |
| Flash point | 181.779°C (Cal.) |
| (1) | David G. Harman and Stephen J. Blanksby. Investigation of the gas phase reactivity of the 1-adamantyl radical using a distonic radical anion approach, Org. Biomol. Chem., 2007, 5, 3495. |
|---|---|
| Market Analysis Reports |