| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Name | D-Ribose 5-(Dihydrogen Phosphate) |
|---|---|
| Synonyms | [(2R,3R,4R)-2,3,4-Trihydroxy-5-Oxo-Pentyl] Dihydrogen Phosphate; [(2R,3R,4R)-2,3,4-Trihydroxy-5-Keto-Pentyl] Dihydrogen Phosphate; Ribose, 5-(Dihydrogen Phosphate) |
| Molecular Structure | ![]() |
| Molecular Formula | C5H11O8P |
| Molecular Weight | 230.11 |
| CAS Registry Number | 4300-28-1 |
| EINECS | 224-310-2 |
| SMILES | [C@@H]([C@@H](CO[P](=O)(O)O)O)([C@H](C=O)O)O |
| InChI | 1S/C5H11O8P/c6-1-3(7)5(9)4(8)2-13-14(10,11)12/h1,3-5,7-9H,2H2,(H2,10,11,12)/t3-,4+,5-/m0/s1 |
| InChIKey | PPQRONHOSHZGFQ-LMVFSUKVSA-N |
| Density | 1.804g/cm3 (Cal.) |
|---|---|
| Boiling point | 559.11°C at 760 mmHg (Cal.) |
| Flash point | 291.939°C (Cal.) |
| (1) | Ariel MuchaWork done during a leave of absence from the University of Wrocław to the University of Zürich., Bernd Knobloch, Małgorzata Jeżowska-Bojczuk, Henryk Kozłowski and Roland K. O. Sigel. Effect of the riboseversus2′-deoxyribose residue on the metal ion-binding properties of purine nucleotides, Dalton Trans., 2008, 5368. |
|---|---|
| Market Analysis Reports |