| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Name | 4-(4-Bromophenyl)-4'-Chlorobenzophenone |
|---|---|
| Synonyms | 4'-Bromo-[1,1'-Biphenyl]-4-Yl-4-Chloro-Phenyl-Methanone; Aids-093441; Aids093441 |
| Molecular Structure | ![]() |
| Molecular Formula | C19H12BrClO |
| Molecular Weight | 371.66 |
| CAS Registry Number | 43007-16-5 |
| EINECS | 256-046-9 |
| SMILES | C2=C(C1=CC=C(Br)C=C1)C=CC(=C2)C(=O)C3=CC=C(Cl)C=C3 |
| InChI | 1S/C19H12BrClO/c20-17-9-5-14(6-10-17)13-1-3-15(4-2-13)19(22)16-7-11-18(21)12-8-16/h1-12H |
| InChIKey | HUKGFXRPOYQFSQ-UHFFFAOYSA-N |
| Density | 1.424g/cm3 (Cal.) |
|---|---|
| Boiling point | 490.153°C at 760 mmHg (Cal.) |
| Flash point | 250.236°C (Cal.) |
| (1) | Philip Prathipati, Ngai Ling Ma* and Thomas H. Keller. Global Bayesian Models for the Prioritization of Antitubercular Agents, J. Chem. Inf. Model., 2008, 48 (12), pp 2362–2370 |
|---|---|
| Market Analysis Reports |