Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 9-Methylidenefluorene |
|---|---|
| Synonyms | 9-Methylenefluorene; 9-Methylene-Fluorene; 9-Methylene-9H-Fluorene |
| Molecular Structure |  |
| Molecular Formula | C14H10 |
| Molecular Weight | 178.23 |
| CAS Registry Number | 4425-82-5 |
| SMILES | C1=CC2=C(C=C1)C(=C)C3=CC=CC=C23 |
| InChI | 1S/C14H10/c1-10-11-6-2-4-8-13(11)14-9-5-3-7-12(10)14/h2-9H,1H2 |
| InChIKey | ZYASLTYCYTYKFC-UHFFFAOYSA-N |
| Density | 1.122g/cm3 (Cal.) |
|---|---|
| Boiling point | 305.851°C at 760 mmHg (Cal.) |
| Flash point | 142.574°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9-Methylidenefluorene |