|
CAS#: 4439-62-7 Product: Rotenonone No suppilers available for the product. |
| Name | Rotenonone |
|---|---|
| Synonyms | C10525; Rotenonone; Chebi:8898 |
| Molecular Structure | ![]() |
| Molecular Formula | C23H18O7 |
| Molecular Weight | 406.39 |
| CAS Registry Number | 4439-62-7 |
| SMILES | [C@@H]1(CC2=C(O1)C=CC3=C2OC5=C(C3=O)C4=C(C=C(C(=C4)OC)OC)OC5=O)C(=C)C |
| InChI | 1S/C23H18O7/c1-10(2)15-8-13-14(28-15)6-5-11-20(24)19-12-7-17(26-3)18(27-4)9-16(12)29-23(25)22(19)30-21(11)13/h5-7,9,15H,1,8H2,2-4H3/t15-/m1/s1 |
| InChIKey | CWZIPBGXMLRVIC-OAHLLOKOSA-N |
| Density | 1.433g/cm3 (Cal.) |
|---|---|
| Boiling point | 615.569°C at 760 mmHg (Cal.) |
| Flash point | 269.177°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Rotenonone |