|
CAS#: 4605-47-4 Product: 2-(2,2,3-Trimethylcyclopent-1-Yl)Ethyl Acetate No suppilers available for the product. |
| Name | 2-(2,2,3-Trimethylcyclopent-1-Yl)Ethyl Acetate |
|---|---|
| Synonyms | Acetic Acid 2-(2,2,3-Trimethylcyclopentyl)Ethyl Ester; 2-(2,2,3-Trimethylcyclopentyl)Ethyl Ethanoate; 2-(2,2,3-Trimethylcyclopent-1-Yl)Ethyl Acetate |
| Molecular Structure | ![]() |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.30 |
| CAS Registry Number | 4605-47-4 |
| EINECS | 225-008-3 |
| SMILES | C(OC(=O)C)CC1C(C(CC1)C)(C)C |
| InChI | 1S/C12H22O2/c1-9-5-6-11(12(9,3)4)7-8-14-10(2)13/h9,11H,5-8H2,1-4H3 |
| InChIKey | XGPBVBUAIVOKAC-UHFFFAOYSA-N |
| Density | 0.897g/cm3 (Cal.) |
|---|---|
| Boiling point | 227.237°C at 760 mmHg (Cal.) |
| Flash point | 89.541°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(2,2,3-Trimethylcyclopent-1-Yl)Ethyl Acetate |