|
CAS#: 46841-90-1 Product: (Z)-2-Butenedioic Acid Hydrogen 1-(2-Phenoxyethyl) Ester No suppilers available for the product. |
| Name | (Z)-2-Butenedioic Acid Hydrogen 1-(2-Phenoxyethyl) Ester |
|---|---|
| Synonyms | (E)-4-Keto-4-[2-(Phenoxy)Ethoxy]But-2-Enoic Acid; 2-Butenedioic Acid (2Z)-, Mono(2-Phenoxyethyl) Ester; Mono(Phenoxyethyl) Maleate |
| Molecular Structure | ![]() |
| Molecular Formula | C12H12O5 |
| Molecular Weight | 236.22 |
| CAS Registry Number | 46841-90-1 |
| SMILES | C1=CC=C(C=C1)OCCOC(=O)\C=C\C(=O)O |
| InChI | 1S/C12H12O5/c13-11(14)6-7-12(15)17-9-8-16-10-4-2-1-3-5-10/h1-7H,8-9H2,(H,13,14)/b7-6+ |
| InChIKey | RUGDBESIUZOJPC-VOTSOKGWSA-N |
| Density | 1.259g/cm3 (Cal.) |
|---|---|
| Boiling point | 428.978°C at 760 mmHg (Cal.) |
| Flash point | 167.171°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (Z)-2-Butenedioic Acid Hydrogen 1-(2-Phenoxyethyl) Ester |