|
CAS#: 47135-88-6 Product: Closiramine No suppilers available for the product. |
| Name | Closiramine |
|---|---|
| Synonyms | Closiramine; Closiraminum [Inn-Latin] |
| Molecular Structure | ![]() |
| Molecular Formula | C18H21ClN2 |
| Molecular Weight | 300.83 |
| CAS Registry Number | 47135-88-6 |
| EINECS | 256-297-4 |
| SMILES | C1=CC(=CC3=C1C(C2=C(C=CC=N2)CC3)CCN(C)C)Cl |
| InChI | 1S/C18H21ClN2/c1-21(2)11-9-17-16-8-7-15(19)12-14(16)6-5-13-4-3-10-20-18(13)17/h3-4,7-8,10,12,17H,5-6,9,11H2,1-2H3 |
| InChIKey | BYUAWKXUYPHXSR-UHFFFAOYSA-N |
| Density | 1.127g/cm3 (Cal.) |
|---|---|
| Boiling point | 406.608°C at 760 mmHg (Cal.) |
| Flash point | 199.709°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Closiramine |