Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | Protheobromine |
|---|---|
| Synonyms | 1-(2-Hydroxypropyl)-3,7-Dimethyl-Purine-2,6-Dione; 1-(2-Hydroxypropyl)-3,7-Dimethyl-Xanthine; Pdsp1_001131 |
| Molecular Structure |  |
| Molecular Formula | C10H14N4O3 |
| Molecular Weight | 238.25 |
| CAS Registry Number | 50-39-5 |
| EINECS | 200-034-8 |
| SMILES | C2=NC1=C(C(N(CC(C)O)C(N1C)=O)=O)[N]2C |
| InChI | 1S/C10H14N4O3/c1-6(15)4-14-9(16)7-8(11-5-12(7)2)13(3)10(14)17/h5-6,15H,4H2,1-3H3 |
| InChIKey | MXRGZXBFSKSZPH-UHFFFAOYSA-N |
| Density | 1.462g/cm3 (Cal.) |
|---|---|
| Boiling point | 493.128°C at 760 mmHg (Cal.) |
| Flash point | 252.035°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Protheobromine |