| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | Levisoprenaline |
|---|---|
| Synonyms | 4-[(1R)-1-Hydroxy-2-(Isopropylamino)Ethyl]Benzene-1,2-Diol; 4-[(1R)-1-Hydroxy-2-(Isopropylamino)Ethyl]Pyrocatechol; Ncgc00016665-01 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 |
| CAS Registry Number | 51-31-0 |
| SMILES | [C@@H](C1=CC(=C(O)C=C1)O)(CNC(C)C)O |
| InChI | 1S/C11H17NO3/c1-7(2)12-6-11(15)8-3-4-9(13)10(14)5-8/h3-5,7,11-15H,6H2,1-2H3/t11-/m0/s1 |
| InChIKey | JWZZKOKVBUJMES-NSHDSACASA-N |
| Density | 1.2g/cm3 (Cal.) |
|---|---|
| Boiling point | 417.48°C at 760 mmHg (Cal.) |
| Flash point | 179.74°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | MacDonald et al.. Identifying off-target effects and hidden phenotypes of drugs in human cells, Nature Chemical Biology, 2006 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Levisoprenaline |