|
CAS#: 52085-70-8 Product: D-glycero-D-ido-Heptonic acid, delta-lactone No suppilers available for the product. |
| Name | D-glycero-D-ido-Heptonic acid, delta-lactone |
|---|---|
| Synonyms | (3S,4R,5R,6R)-6-[(1R)-1,2-Dihydroxyethyl]-3,4,5-Trihydroxy-Tetrahydropyran-2-One; (3S,4R,5R,6R)-6-[(1R)-1,2-Dihydroxyethyl]-3,4,5-Trihydroxy-2-Tetrahydropyranone; (3S,4R,5R,6R)-6-[(1R)-1,2-Dihydroxyethyl]-3,4,5-Trihydroxy-Oxan-2-One |
| Molecular Structure | ![]() |
| Molecular Formula | C7H12O7 |
| Molecular Weight | 208.17 |
| CAS Registry Number | 52085-70-8 |
| EINECS | 257-653-1 |
| SMILES | [C@@H]1(OC(=O)[C@H]([C@@H]([C@H]1O)O)O)[C@H](O)CO |
| InChI | 1S/C7H12O7/c8-1-2(9)6-4(11)3(10)5(12)7(13)14-6/h2-6,8-12H,1H2/t2-,3-,4-,5+,6-/m1/s1 |
| InChIKey | SUNCWTXGGFSVJR-DGPNFKTASA-N |
| Density | 1.801g/cm3 (Cal.) |
|---|---|
| Boiling point | 540.685°C at 760 mmHg (Cal.) |
| Flash point | 225.328°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for D-glycero-D-ido-Heptonic acid, delta-lactone |