|
CAS#: 53718-32-4 Product: 1,3,3-Trimethyl-1-Phenylindan-5-Ol No suppilers available for the product. |
| Name | 1,3,3-Trimethyl-1-Phenylindan-5-Ol |
|---|---|
| Synonyms | 1,3,3-Trimethyl-1-Phenyl-Indan-5-Ol; 1,3,3-Trimethyl-1-Phenyl-5-Indanol; 1,3,3-Trimethyl-1-Phenylindan-5-Ol |
| Molecular Structure | ![]() |
| Molecular Formula | C18H20O |
| Molecular Weight | 252.36 |
| CAS Registry Number | 53718-32-4 |
| EINECS | 258-720-8 |
| SMILES | C1=CC(=CC2=C1C(CC2(C)C)(C3=CC=CC=C3)C)O |
| InChI | 1S/C18H20O/c1-17(2)12-18(3,13-7-5-4-6-8-13)15-10-9-14(19)11-16(15)17/h4-11,19H,12H2,1-3H3 |
| InChIKey | XCRNADHTKBRCAN-UHFFFAOYSA-N |
| Density | 1.06g/cm3 (Cal.) |
|---|---|
| Boiling point | 376.196°C at 760 mmHg (Cal.) |
| Flash point | 177.61°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3,3-Trimethyl-1-Phenylindan-5-Ol |