|
CAS#: 54983-54-9 Product: Sodium 4-Chloro-3,5-Dimethylphenolate No suppilers available for the product. |
| Name | Sodium 4-Chloro-3,5-Dimethylphenolate |
|---|---|
| Synonyms | Sodium 4-Chloro-3,5-Dimethyl-Phenolate; Phenol, 4-Chloro-3,5-Dimethyl-, Sodium Salt |
| Molecular Structure | ![]() |
| Molecular Formula | C8H8ClNaO |
| Molecular Weight | 178.59 |
| CAS Registry Number | 54983-54-9 |
| EINECS | 259-424-1 |
| SMILES | C1=C([O-])C=C(C(=C1C)Cl)C.[Na+] |
| InChI | 1S/C8H9ClO.Na/c1-5-3-7(10)4-6(2)8(5)9;/h3-4,10H,1-2H3;/q;+1/p-1 |
| InChIKey | IUJGTVGVLAYVKG-UHFFFAOYSA-M |
| Boiling point | 246°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 105.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Sodium 4-Chloro-3,5-Dimethylphenolate |