|
CAS#: 55695-80-2 Product: Lithium L-Glutamate No suppilers available for the product. |
| Name | Lithium L-Glutamate |
|---|---|
| Synonyms | Lithium (4S)-4-Amino-5-Hydroxy-5-Oxo-Pentanoate; Lithium (4S)-4-Amino-5-Hydroxy-5-Keto-Valerate |
| Molecular Structure | ![]() |
| Molecular Formula | C5H8LiNO4 |
| Molecular Weight | 153.06 |
| CAS Registry Number | 55695-80-2 |
| EINECS | 259-761-4 |
| SMILES | [C@@H](N)(C(=O)O)CCC([O-])=O.[Li+] |
| InChI | 1S/C5H9NO4.Li/c6-3(5(9)10)1-2-4(7)8;/h3H,1-2,6H2,(H,7,8)(H,9,10);/q;+1/p-1/t3-;/m0./s1 |
| InChIKey | HHQBFDZABIXCDF-DFWYDOINSA-M |
| Boiling point | 333.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 155.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Lithium L-Glutamate |