|
CAS#: 56504-52-0 Product: 8,9-Dichloro-4-Thia-1,3-Diazatricyclo[5.3.1.02,6]Undeca-2,5-Diene No suppilers available for the product. |
| Name | 8,9-Dichloro-4-Thia-1,3-Diazatricyclo[5.3.1.02,6]Undeca-2,5-Diene |
|---|---|
| Synonyms | 4,5-Dichloro-3-piperidinoylisothiazole |
| Molecular Structure | ![]() |
| Molecular Formula | C8H8Cl2N2S |
| Molecular Weight | 235.13 |
| CAS Registry Number | 56504-52-0 |
| SMILES | C1C2C(C(CN1C3=NSC=C23)Cl)Cl |
| InChI | 1S/C8H8Cl2N2S/c9-6-2-12-1-4(7(6)10)5-3-13-11-8(5)12/h3-4,6-7H,1-2H2 |
| InChIKey | DMAGQCWYYNPMSU-UHFFFAOYSA-N |
| Density | 1.6±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 292.5±40.0°C at 760 mmHg (Cal.) |
| Flash point | 130.7±27.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 8,9-Dichloro-4-Thia-1,3-Diazatricyclo[5.3.1.02,6]Undeca-2,5-Diene |