|
CAS#: 56676-71-2 Product: N-Phenylglycine Hydrochloride No suppilers available for the product. |
| Name | N-Phenylglycine Hydrochloride |
|---|---|
| Synonyms | 2-Phenylazanylethanoic Acid Hydrochloride; N-Phenylglycine Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C8H10ClNO2 |
| Molecular Weight | 187.63 |
| CAS Registry Number | 56676-71-2 |
| EINECS | 260-329-2 |
| SMILES | [H+].C1=C(NCC(O)=O)C=CC=C1.[Cl-] |
| InChI | 1S/C8H9NO2.ClH/c10-8(11)6-9-7-4-2-1-3-5-7;/h1-5,9H,6H2,(H,10,11);1H |
| InChIKey | HIQIUINFXZKKEC-UHFFFAOYSA-N |
| Boiling point | 359°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 170.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Phenylglycine Hydrochloride |